
Current location:Home > Product > Pharmaceutical API


|
General Description |
L-Arginine mono(4-methyl-2-oxovalerate) is a chemical compound that consists of the amino acid L-Arginine bound to the organic compound 4-methyl-2-oxovalerate. L-Arginine is a semi-essential amino acid that plays a crucial role in protein synthesis, immune function, and the production of nitric oxide. It is commonly found in foods such as meat, fish, and dairy products. 4-methyl-2-oxovalerate, on the other hand, is a derivative of 2-oxovaleric acid, an organic acid involved in various metabolic pathways. L-Arginine mono(4-methyl-2-oxovalerate) is not as well-studied as L-Arginine, but it likely contributes to the overall properties and applications of L-Arginine mono(4-methyl-2-oxovalerate) in research and industrial settings. |
InChI:InChI=1/C6H14N4O2.C6H10O3/c7-4(5(11)12)2-1-3-10-6(8)9;1-4(2)3-5(7)6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);4H,3H2,1-2H3,(H,8,9)
L-arginine mono(4-methyl-2-oxovalerate)
| Conditions | Yield |
|---|---|
|
aus den Komponenten;
|
