What is the 5-deazaflavin?

5-deazaflavin is , while it's Molecular Formula is C11H7 N3 O2.

What is the CAS number for 5-deazaflavin?

The CAS number of 5-deazaflavin is 26908-38-3.

What is 5-deazaflavin (26908-38-3) used for?

5-Deazaflavin is a biomimetic coenzyme analog involved in asymmetric reduction reactions, where its chiral derivatives can discriminate enantiotopic faces of carbonyl compounds. It exhibits nucleophilic reactivity at the 5-position, forming stable adducts with water, alcohols, amines, and metalorganic compounds, enabling the synthesis of various substituted derivatives. 5-deazaflavin's structural flexibility allows it to serve as a functional model for enzymatic systems, particularly in redox processes.InChI:InChI=1/C11H7N3O2/c15-10-7-5-6-3-1-2-4-8(6)12-9(7)13-11(16)14-10/h1-5H,(H2,12,13,14,15,16)

What is the 5-deazaflavin?

5-deazaflavin is , while it's Molecular Formula is C11H7 N3 O2.

What is the CAS number for 5-deazaflavin?

The CAS number of 5-deazaflavin is 26908-38-3.

What is 5-deazaflavin (26908-38-3) used for?

5-Deazaflavin is a biomimetic coenzyme analog involved in asymmetric reduction reactions, where its chiral derivatives can discriminate enantiotopic faces of carbonyl compounds. It exhibits nucleophilic reactivity at the 5-position, forming stable adducts with water, alcohols, amines, and metalorganic compounds, enabling the synthesis of various substituted derivatives. 5-deazaflavin's structural flexibility allows it to serve as a functional model for enzymatic systems, particularly in redox processes.InChI:InChI=1/C11H7N3O2/c15-10-7-5-6-3-1-2-4-8(6)12-9(7)13-11(16)14-10/h1-5H,(H2,12,13,14,15,16)