
Current location:Home > Product > Pharmaceutical API


|
General Description |
2-Ketoglutaric acid, magnesium salt is a compound formed by combining 2-ketoglutaric acid with magnesium. 2-ketoglutaric acid is a key intermediate in the Krebs cycle, which is involved in the production of cellular energy. Magnesium is an essential mineral that plays a crucial role in various physiological processes, including muscle and nerve function, DNA synthesis, and energy production. The combination of 2-ketoglutaric acid with magnesium provides a form of the compound that may be more easily absorbed in the body, potentially offering benefits in energy production and cellular function. Additionally, magnesium may also provide its own health benefits, such as support for cardiovascular health and muscle function. |
InChI:InChI=1/C5H6O5.Mg/c6-3(5(9)10)1-2-4(7)8;/h1-2H2,(H,7,8)(H,9,10);/q;+2
